C17H16ClNO2 — CID 10662074
(E)-5-anilino-5-(4-chlorophenyl)pent-2-enoic acid (PubChem CID 10662074) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is (E)-5-anilino-5-(4-chlorophenyl)pent-2-enoic acid.
| Compound Name | (E)-5-anilino-5-(4-chlorophenyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 10662074 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (E)-5-anilino-5-(4-chlorophenyl)pent-2-enoic acid |
| SMILES | O=C(O)/C=C/CC(Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO2/c18-14-11-9-13(10-12-14)16(7-4-8-17(20)21)19-15-5-2-1-3-6-15/h1-6,8-12,16,19H,7H2,(H,20,21)/b8-4+ |
| InChIKey | GNATWXSACVPJAX-XBXARRHUSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|