C12H17BrN4O3 — CID 106621301
2-[(5-bromo-3-nitro-2-pyridinyl)-(pyrrolidin-2-ylmethyl)amino]ethanol (PubChem CID 106621301) has the molecular formula C12H17BrN4O3 and a molecular weight of 345.20 g/mol. Its IUPAC name is 2-[(5-bromo-3-nitro-2-pyridinyl)-(pyrrolidin-2-ylmethyl)amino]ethanol.
| Compound Name | 2-[(5-bromo-3-nitro-2-pyridinyl)-(pyrrolidin-2-ylmethyl)amino]ethanol |
|---|---|
| PubChem CID | 106621301 |
| Molecular Formula | C12H17BrN4O3 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-[(5-bromo-3-nitro-2-pyridinyl)-(pyrrolidin-2-ylmethyl)amino]ethanol |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1N(CCO)CC1CCCN1 |
| InChI | InChI=1S/C12H17BrN4O3/c13-9-6-11(17(19)20)12(15-7-9)16(4-5-18)8-10-2-1-3-14-10/h6-7,10,14,18H,1-5,8H2 |
| InChIKey | XVQVCAHXNIKTPW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|