C10H13BrN4O2 — CID 62542196
5-bromo-3-nitro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine (PubChem CID 62542196) has the molecular formula C10H13BrN4O2 and a molecular weight of 301.14 g/mol. Its IUPAC name is 5-bromo-3-nitro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-nitro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62542196 |
| Molecular Formula | C10H13BrN4O2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 5-bromo-3-nitro-N-(pyrrolidin-2-ylmethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1NCC1CCCN1 |
| InChI | InChI=1S/C10H13BrN4O2/c11-7-4-9(15(16)17)10(13-5-7)14-6-8-2-1-3-12-8/h4-5,8,12H,1-3,6H2,(H,13,14) |
| InChIKey | NIMDBDRCZLKELY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|