C14H20BrN3O3 — CID 133384900
2-[3-[(5-bromo-3-nitro-2-pyridinyl)amino]propyl]cyclohexan-1-ol (PubChem CID 133384900) has the molecular formula C14H20BrN3O3 and a molecular weight of 358.24 g/mol. Its IUPAC name is 2-[3-[(5-bromo-3-nitro-2-pyridinyl)amino]propyl]cyclohexan-1-ol.
| Compound Name | 2-[3-[(5-bromo-3-nitro-2-pyridinyl)amino]propyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133384900 |
| Molecular Formula | C14H20BrN3O3 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[3-[(5-bromo-3-nitro-2-pyridinyl)amino]propyl]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1NCCCC1CCCCC1O |
| InChI | InChI=1S/C14H20BrN3O3/c15-11-8-12(18(20)21)14(17-9-11)16-7-3-5-10-4-1-2-6-13(10)19/h8-10,13,19H,1-7H2,(H,16,17) |
| InChIKey | YUTYHXUVXJYADT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|