C16H18O4S — CID 10662435
methyl (1R,5R,6S)-5-methyl-3-oxo-6-phenylsulfanyl-8-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10662435) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is methyl (1R,5R,6S)-5-methyl-3-oxo-6-phenylsulfanyl-8-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,5R,6S)-5-methyl-3-oxo-6-phenylsulfanyl-8-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10662435 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | methyl (1R,5R,6S)-5-methyl-3-oxo-6-phenylsulfanyl-8-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@@]2(C)O[C@@H]1C[C@@H]2Sc1ccccc1 |
| InChI | InChI=1S/C16H18O4S/c1-16-9-11(17)14(15(18)19-2)12(20-16)8-13(16)21-10-6-4-3-5-7-10/h3-7,12-14H,8-9H2,1-2H3/t12-,13+,14?,16-/m1/s1 |
| InChIKey | OQUXBVXRXLYHCT-LBEMJPCMSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|