C19H34O3 — CID 10662771
[(2R)-2-[[(1S,2S,5R)-5-methyl-2-propan-2-yl-1-prop-2-enylcyclohexyl]oxymethyl]oxolan-2-yl]methanol (PubChem CID 10662771) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is [(2R)-2-[[(1S,2S,5R)-5-methyl-2-propan-2-yl-1-prop-2-enylcyclohexyl]oxymethyl]oxolan-2-yl]methanol.
| Compound Name | [(2R)-2-[[(1S,2S,5R)-5-methyl-2-propan-2-yl-1-prop-2-enylcyclohexyl]oxymethyl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 10662771 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | [(2R)-2-[[(1S,2S,5R)-5-methyl-2-propan-2-yl-1-prop-2-enylcyclohexyl]oxymethyl]oxolan-2-yl]methanol |
| SMILES | C=CC[C@]1(OC[C@]2(CO)CCCO2)C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C19H34O3/c1-5-9-19(12-16(4)7-8-17(19)15(2)3)22-14-18(13-20)10-6-11-21-18/h5,15-17,20H,1,6-14H2,2-4H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | GFQQVYSGRHAKOA-HCXYKTFWSA-N |
| XLogP | 3.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|