C9H14FN3S — CID 106634978
5-[fluoro(piperidin-2-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 106634978) has the molecular formula C9H14FN3S and a molecular weight of 215.30 g/mol. Its IUPAC name is 5-[fluoro(piperidin-2-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[fluoro(piperidin-2-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106634978 |
| Molecular Formula | C9H14FN3S |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 5-[fluoro(piperidin-2-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(C(F)C2CCCCN2)s1 |
| InChI | InChI=1S/C9H14FN3S/c10-8(6-3-1-2-4-12-6)7-5-13-9(11)14-7/h5-6,8,12H,1-4H2,(H2,11,13) |
| InChIKey | RGZUEFGDUIYZOI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |