C7H9ClO6P2S — CID 10663531
[(4-chlorophenyl)sulfanyl-phosphono(114C)methyl]phosphonic acid (PubChem CID 10663531) has the molecular formula C7H9ClO6P2S and a molecular weight of 320.60 g/mol. Its IUPAC name is [(4-chlorophenyl)sulfanyl-phosphono(114C)methyl]phosphonic acid.
| Compound Name | [(4-chlorophenyl)sulfanyl-phosphono(114C)methyl]phosphonic acid |
|---|---|
| PubChem CID | 10663531 |
| Molecular Formula | C7H9ClO6P2S |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | [(4-chlorophenyl)sulfanyl-phosphono(114C)methyl]phosphonic acid |
| SMILES | O=P(O)(O)[14CH](Sc1ccc(Cl)cc1)P(=O)(O)O |
| InChI | InChI=1S/C7H9ClO6P2S/c8-5-1-3-6(4-2-5)17-7(15(9,10)11)16(12,13)14/h1-4,7H,(H2,9,10,11)(H2,12,13,14)/i7+2 |
| InChIKey | DKJJVAGXPKPDRL-WGGUOBTBSA-N |
| XLogP | 2.07 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|