C16H19NO2S2 — CID 10663585
(5Z)-5-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 10663585) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is (5Z)-5-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10663585 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (5Z)-5-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1cc(/C=C2\SC(=S)NC2=O)cc(C(C)C)c1O |
| InChI | InChI=1S/C16H19NO2S2/c1-8(2)11-5-10(6-12(9(3)4)14(11)18)7-13-15(19)17-16(20)21-13/h5-9,18H,1-4H3,(H,17,19,20)/b13-7- |
| InChIKey | COEMJFJCGZZITG-QPEQYQDCSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|