C15H19N3 — CID 106637585
N-(pyrrolidin-2-ylmethyl)-3-pyrrol-1-ylaniline (PubChem CID 106637585) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N-(pyrrolidin-2-ylmethyl)-3-pyrrol-1-ylaniline.
| Compound Name | N-(pyrrolidin-2-ylmethyl)-3-pyrrol-1-ylaniline |
|---|---|
| PubChem CID | 106637585 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-(pyrrolidin-2-ylmethyl)-3-pyrrol-1-ylaniline |
| SMILES | c1cc(NCC2CCCN2)cc(-n2cccc2)c1 |
| InChI | InChI=1S/C15H19N3/c1-2-10-18(9-1)15-7-3-5-13(11-15)17-12-14-6-4-8-16-14/h1-3,5,7,9-11,14,16-17H,4,6,8,12H2 |
| InChIKey | ICQWLQALJYOMJM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |