C14H28N2O2S — CID 106639321
tert-butyl 2-[(2-methylsulfanylpropylamino)methyl]pyrrolidine-1-carboxylate (PubChem CID 106639321) has the molecular formula C14H28N2O2S and a molecular weight of 288.46 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylsulfanylpropylamino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2-methylsulfanylpropylamino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106639321 |
| Molecular Formula | C14H28N2O2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | tert-butyl 2-[(2-methylsulfanylpropylamino)methyl]pyrrolidine-1-carboxylate |
| SMILES | CSC(C)CNCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O2S/c1-11(19-5)9-15-10-12-7-6-8-16(12)13(17)18-14(2,3)4/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | PZZXOFRAVKZJPQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |