C12H22FNO2S — CID 106640581
2-[fluoro-(3-methylsulfonylcyclohexyl)methyl]pyrrolidine (PubChem CID 106640581) has the molecular formula C12H22FNO2S and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-[fluoro-(3-methylsulfonylcyclohexyl)methyl]pyrrolidine.
| Compound Name | 2-[fluoro-(3-methylsulfonylcyclohexyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 106640581 |
| Molecular Formula | C12H22FNO2S |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-[fluoro-(3-methylsulfonylcyclohexyl)methyl]pyrrolidine |
| SMILES | CS(=O)(=O)C1CCCC(C(F)C2CCCN2)C1 |
| InChI | InChI=1S/C12H22FNO2S/c1-17(15,16)10-5-2-4-9(8-10)12(13)11-6-3-7-14-11/h9-12,14H,2-8H2,1H3 |
| InChIKey | STCYDONGUOAIBV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |