C16H22F2N2 — CID 106648712
[1-[(1E)-cycloocten-1-yl]-2-(3,5-difluorophenyl)ethyl]hydrazine (PubChem CID 106648712) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is [1-[(1E)-cycloocten-1-yl]-2-(3,5-difluorophenyl)ethyl]hydrazine.
| Compound Name | [1-[(1E)-cycloocten-1-yl]-2-(3,5-difluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106648712 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [1-[(1E)-cycloocten-1-yl]-2-(3,5-difluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cc(F)cc(F)c1)/C1=C/CCCCCC1 |
| InChI | InChI=1S/C16H22F2N2/c17-14-8-12(9-15(18)11-14)10-16(20-19)13-6-4-2-1-3-5-7-13/h6,8-9,11,16,20H,1-5,7,10,19H2/b13-6+ |
| InChIKey | WMQHGCXSDRLTSJ-AWNIVKPZSA-N |
| XLogP | 3.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|