C15H20F2N2 — CID 106648713
[1-(cyclohepten-1-yl)-2-(3,5-difluorophenyl)ethyl]hydrazine (PubChem CID 106648713) has the molecular formula C15H20F2N2 and a molecular weight of 266.33 g/mol. Its IUPAC name is [1-(cyclohepten-1-yl)-2-(3,5-difluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(cyclohepten-1-yl)-2-(3,5-difluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106648713 |
| Molecular Formula | C15H20F2N2 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [1-(cyclohepten-1-yl)-2-(3,5-difluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cc(F)cc(F)c1)C1=CCCCCC1 |
| InChI | InChI=1S/C15H20F2N2/c16-13-7-11(8-14(17)10-13)9-15(19-18)12-5-3-1-2-4-6-12/h5,7-8,10,15,19H,1-4,6,9,18H2 |
| InChIKey | GYRAXOYECQYFAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|