C17H21BrO3 — CID 106651072
(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-[(1E)-cycloocten-1-yl]methanol (PubChem CID 106651072) has the molecular formula C17H21BrO3 and a molecular weight of 353.26 g/mol. Its IUPAC name is (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-[(1E)-cycloocten-1-yl]methanol.
| Compound Name | (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-[(1E)-cycloocten-1-yl]methanol |
|---|---|
| PubChem CID | 106651072 |
| Molecular Formula | C17H21BrO3 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-[(1E)-cycloocten-1-yl]methanol |
| SMILES | OC(/C1=C/CCCCCC1)c1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C17H21BrO3/c18-14-10-13(11-15-17(14)21-9-8-20-15)16(19)12-6-4-2-1-3-5-7-12/h6,10-11,16,19H,1-5,7-9H2/b12-6+ |
| InChIKey | RFYANXDWGQCAGE-WUXMJOGZSA-N |
| XLogP | 4.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|