C15H17BrO3 — CID 106651073
(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(cyclohexen-1-yl)methanol (PubChem CID 106651073) has the molecular formula C15H17BrO3 and a molecular weight of 325.20 g/mol. Its IUPAC name is (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(cyclohexen-1-yl)methanol.
| Compound Name | (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(cyclohexen-1-yl)methanol |
|---|---|
| PubChem CID | 106651073 |
| Molecular Formula | C15H17BrO3 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(cyclohexen-1-yl)methanol |
| SMILES | OC(C1=CCCCC1)c1cc(Br)c2c(c1)OCCO2 |
| InChI | InChI=1S/C15H17BrO3/c16-12-8-11(9-13-15(12)19-7-6-18-13)14(17)10-4-2-1-3-5-10/h4,8-9,14,17H,1-3,5-7H2 |
| InChIKey | VYBIMEZNWSCMQF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|