C14H27NS — CID 106653131
1-(cyclohepten-1-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine (PubChem CID 106653131) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine.
| Compound Name | 1-(cyclohepten-1-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine |
|---|---|
| PubChem CID | 106653131 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 1-(cyclohepten-1-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine |
| SMILES | CCNC(CSC(C)C)C1=CCCCCC1 |
| InChI | InChI=1S/C14H27NS/c1-4-15-14(11-16-12(2)3)13-9-7-5-6-8-10-13/h9,12,14-15H,4-8,10-11H2,1-3H3 |
| InChIKey | CPECBEDDIBTWDW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|