C19H29N3OS — CID 10665353
3-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one (PubChem CID 10665353) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10665353 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(N2CCN(CCCCN3CSCC3=O)CC2)c1C |
| InChI | InChI=1S/C19H29N3OS/c1-16-6-5-7-18(17(16)2)21-12-10-20(11-13-21)8-3-4-9-22-15-24-14-19(22)23/h5-7H,3-4,8-15H2,1-2H3 |
| InChIKey | NDHQLVTVKGJPKD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|