C14H19BrN2 — CID 106654365
N-[(3-bromo-2-pyridinyl)-(cyclohexen-1-yl)methyl]ethanamine (PubChem CID 106654365) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is N-[(3-bromo-2-pyridinyl)-(cyclohexen-1-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-2-pyridinyl)-(cyclohexen-1-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106654365 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-[(3-bromo-2-pyridinyl)-(cyclohexen-1-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCC1)c1ncccc1Br |
| InChI | InChI=1S/C14H19BrN2/c1-2-16-13(11-7-4-3-5-8-11)14-12(15)9-6-10-17-14/h6-7,9-10,13,16H,2-5,8H2,1H3 |
| InChIKey | KINOTHUFFXKKRT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|