C12H19F4NO — CID 106654842
1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 106654842) has the molecular formula C12H19F4NO and a molecular weight of 269.28 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 106654842 |
| Molecular Formula | C12H19F4NO |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)C1=CCCCCC1 |
| InChI | InChI=1S/C12H19F4NO/c13-11(14)12(15,16)8-18-7-10(17)9-5-3-1-2-4-6-9/h5,10-11H,1-4,6-8,17H2 |
| InChIKey | GEVJTYSMXQSLBV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|