C13H18N2OS — CID 106655376
2-(2-amino-1,3-thiazol-4-yl)-1-(cycloocten-1-yl)ethanone (PubChem CID 106655376) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-1-(cycloocten-1-yl)ethanone.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-1-(cycloocten-1-yl)ethanone |
|---|---|
| PubChem CID | 106655376 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-1-(cycloocten-1-yl)ethanone |
| SMILES | Nc1nc(CC(=O)C2=CCCCCCC2)cs1 |
| InChI | InChI=1S/C13H18N2OS/c14-13-15-11(9-17-13)8-12(16)10-6-4-2-1-3-5-7-10/h6,9H,1-5,7-8H2,(H2,14,15) |
| InChIKey | IOZFRYUOXRTWKW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |