C9H8N4OS — CID 116575743
2-(2-amino-1,3-thiazol-4-yl)-1-pyrazin-2-ylethanone (PubChem CID 116575743) has the molecular formula C9H8N4OS and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-1-pyrazin-2-ylethanone.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-1-pyrazin-2-ylethanone |
|---|---|
| PubChem CID | 116575743 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-1-pyrazin-2-ylethanone |
| SMILES | Nc1nc(CC(=O)c2cnccn2)cs1 |
| InChI | InChI=1S/C9H8N4OS/c10-9-13-6(5-15-9)3-8(14)7-4-11-1-2-12-7/h1-2,4-5H,3H2,(H2,10,13) |
| InChIKey | GVROPQHEXRNTJK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |