About 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone
2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone (PubChem CID 116575594) has the molecular formula C9H10N4OS
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone |
| PubChem CID | 116575594 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone |
| SMILES | Cn1nccc1C(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C9H10N4OS/c1-13-7(2-3-11-13)8(14)4-6-5-15-9(10)12-6/h2-3,5H,4H2,1H3,(H2,10,12) |
| InChIKey | YRERLRVXSHRVRS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone?
The IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone (CID 116575594) is 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone?
The canonical SMILES for 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone is Cn1nccc1C(=O)Cc1csc(N)n1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone?
The InChIKey is YRERLRVXSHRVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4OS/c1-13-7(2-3-11-13)8(14)4-6-5-15-9(10)12-6/h2-3,5H,4H2,1H3,(H2,10,12).
What are the key properties of 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone?
2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone has a molecular weight of 222.27 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-4-yl)-1-(2-methylpyrazol-3-yl)ethanone is sourced from PubChem (CID 116575594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).