C16H20N2O2 — CID 106658761
N-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methylquinolin-8-amine (PubChem CID 106658761) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methylquinolin-8-amine.
| Compound Name | N-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methylquinolin-8-amine |
|---|---|
| PubChem CID | 106658761 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(2,2-dimethyl-1,3-dioxan-5-yl)-2-methylquinolin-8-amine |
| SMILES | Cc1ccc2cccc(NC3COC(C)(C)OC3)c2n1 |
| InChI | InChI=1S/C16H20N2O2/c1-11-7-8-12-5-4-6-14(15(12)17-11)18-13-9-19-16(2,3)20-10-13/h4-8,13,18H,9-10H2,1-3H3 |
| InChIKey | ROSUOEWKKIGQPU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |