C15H19N3 — CID 62953939
2-methyl-N-piperidin-3-ylquinolin-8-amine (PubChem CID 62953939) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-methyl-N-piperidin-3-ylquinolin-8-amine.
| Compound Name | 2-methyl-N-piperidin-3-ylquinolin-8-amine |
|---|---|
| PubChem CID | 62953939 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-methyl-N-piperidin-3-ylquinolin-8-amine |
| SMILES | Cc1ccc2cccc(NC3CCCNC3)c2n1 |
| InChI | InChI=1S/C15H19N3/c1-11-7-8-12-4-2-6-14(15(12)17-11)18-13-5-3-9-16-10-13/h2,4,6-8,13,16,18H,3,5,9-10H2,1H3 |
| InChIKey | JUQXODOOJHOWER-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |