C13H20NSi+ — CID 10666663
3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane (PubChem CID 10666663) has the molecular formula C13H20NSi+ and a molecular weight of 218.40 g/mol. Its IUPAC name is 3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane.
| Compound Name | 3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane |
|---|---|
| PubChem CID | 10666663 |
| Molecular Formula | C13H20NSi+ |
| Molecular Weight | 218.40 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3,4-dihydroisoquinolin-2-ium-2-ylmethyl(trimethyl)silane |
| SMILES | C[Si](C)(C)C[N+]1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C13H20NSi/c1-15(2,3)11-14-9-8-12-6-4-5-7-13(12)10-14/h4-7,10H,8-9,11H2,1-3H3/q+1 |
| InChIKey | WCGQFODMSHYAKM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|