C17H18IN — CID 135007199
(3S,4R)-2,3-dimethyl-4-phenyl-3,4-dihydroisoquinolin-2-ium iodide (PubChem CID 135007199) has the molecular formula C17H18IN and a molecular weight of 363.24 g/mol. Its IUPAC name is (3S,4R)-2,3-dimethyl-4-phenyl-3,4-dihydroisoquinolin-2-ium iodide.
| Compound Name | (3S,4R)-2,3-dimethyl-4-phenyl-3,4-dihydroisoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 135007199 |
| Molecular Formula | C17H18IN |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (3S,4R)-2,3-dimethyl-4-phenyl-3,4-dihydroisoquinolin-2-ium iodide |
| SMILES | C[C@H]1[C@H](c2ccccc2)c2ccccc2C=[N+]1C.[I-] |
| InChI | InChI=1S/C17H18N.HI/c1-13-17(14-8-4-3-5-9-14)16-11-7-6-10-15(16)12-18(13)2;/h3-13,17H,1-2H3;1H/q+1;/p-1/t13-,17+;/m0./s1 |
| InChIKey | KFFSTURCAFTKLT-OZIFAFRSSA-M |
| XLogP | 0.29 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|