C13H16N2O3S — CID 106669510
3-(3,4-dihydroxypyrrolidin-1-yl)-3-oxo-2-phenylpropanethioamide (PubChem CID 106669510) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidin-1-yl)-3-oxo-2-phenylpropanethioamide.
| Compound Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-3-oxo-2-phenylpropanethioamide |
|---|---|
| PubChem CID | 106669510 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-3-oxo-2-phenylpropanethioamide |
| SMILES | NC(=S)C(C(=O)N1CC(O)C(O)C1)c1ccccc1 |
| InChI | InChI=1S/C13H16N2O3S/c14-12(19)11(8-4-2-1-3-5-8)13(18)15-6-9(16)10(17)7-15/h1-5,9-11,16-17H,6-7H2,(H2,14,19) |
| InChIKey | MGQQUPMPJHHKDQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|