C13H13N3O3S — CID 66083061
3-(3,5-dioxopiperazin-1-yl)-3-oxo-2-phenylpropanethioamide (PubChem CID 66083061) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-(3,5-dioxopiperazin-1-yl)-3-oxo-2-phenylpropanethioamide.
| Compound Name | 3-(3,5-dioxopiperazin-1-yl)-3-oxo-2-phenylpropanethioamide |
|---|---|
| PubChem CID | 66083061 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-(3,5-dioxopiperazin-1-yl)-3-oxo-2-phenylpropanethioamide |
| SMILES | NC(=S)C(C(=O)N1CC(=O)NC(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O3S/c14-12(20)11(8-4-2-1-3-5-8)13(19)16-6-9(17)15-10(18)7-16/h1-5,11H,6-7H2,(H2,14,20)(H,15,17,18) |
| InChIKey | RJSCJVSWUUDXIA-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|