C14H18N2O2S — CID 62972948
3-(1,4-oxazepan-4-yl)-3-oxo-2-phenylpropanethioamide (PubChem CID 62972948) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-(1,4-oxazepan-4-yl)-3-oxo-2-phenylpropanethioamide.
| Compound Name | 3-(1,4-oxazepan-4-yl)-3-oxo-2-phenylpropanethioamide |
|---|---|
| PubChem CID | 62972948 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(1,4-oxazepan-4-yl)-3-oxo-2-phenylpropanethioamide |
| SMILES | NC(=S)C(C(=O)N1CCCOCC1)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O2S/c15-13(19)12(11-5-2-1-3-6-11)14(17)16-7-4-9-18-10-8-16/h1-3,5-6,12H,4,7-10H2,(H2,15,19) |
| InChIKey | SMYUFQAIHXQWBF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|