C6H13N3O2 — CID 106669803
2-(3,4-dihydroxypyrrolidin-1-yl)ethanimidamide (PubChem CID 106669803) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-(3,4-dihydroxypyrrolidin-1-yl)ethanimidamide.
| Compound Name | 2-(3,4-dihydroxypyrrolidin-1-yl)ethanimidamide |
|---|---|
| PubChem CID | 106669803 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-(3,4-dihydroxypyrrolidin-1-yl)ethanimidamide |
| SMILES | [H]/N=C(\N)CN1CC(O)C(O)C1 |
| InChI | InChI=1S/C6H13N3O2/c7-6(8)3-9-1-4(10)5(11)2-9/h4-5,10-11H,1-3H2,(H3,7,8) |
| InChIKey | IDHHYLBNNFYIDS-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|