C7H13N3O4 — CID 106670930
3-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxy-3-oxopropanimidamide (PubChem CID 106670930) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxy-3-oxopropanimidamide.
| Compound Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxy-3-oxopropanimidamide |
|---|---|
| PubChem CID | 106670930 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxy-3-oxopropanimidamide |
| SMILES | NC(CC(=O)N1CC(O)C(O)C1)=NO |
| InChI | InChI=1S/C7H13N3O4/c8-6(9-14)1-7(13)10-2-4(11)5(12)3-10/h4-5,11-12,14H,1-3H2,(H2,8,9) |
| InChIKey | BYJYBYNVHXMGRK-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|