C9H17N3O4 — CID 106670936
2-(3,4-dihydroxypyrrolidine-1-carbonyl)-N'-hydroxybutanimidamide (PubChem CID 106670936) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(3,4-dihydroxypyrrolidine-1-carbonyl)-N'-hydroxybutanimidamide.
| Compound Name | 2-(3,4-dihydroxypyrrolidine-1-carbonyl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 106670936 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-(3,4-dihydroxypyrrolidine-1-carbonyl)-N'-hydroxybutanimidamide |
| SMILES | CCC(C(=O)N1CC(O)C(O)C1)C(N)=NO |
| InChI | InChI=1S/C9H17N3O4/c1-2-5(8(10)11-16)9(15)12-3-6(13)7(14)4-12/h5-7,13-14,16H,2-4H2,1H3,(H2,10,11) |
| InChIKey | JXIHPKAEIBOSHG-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|