C9H19N3O4 — CID 76923602
3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2-dimethylpropanamide (PubChem CID 76923602) has the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2-dimethylpropanamide.
| Compound Name | 3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 76923602 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-amino-3-hydroxyimino-N-(2-hydroxy-3-methoxypropyl)-N,2-dimethylpropanamide |
| SMILES | COCC(O)CN(C)C(=O)C(C)C(N)=NO |
| InChI | InChI=1S/C9H19N3O4/c1-6(8(10)11-15)9(14)12(2)4-7(13)5-16-3/h6-7,13,15H,4-5H2,1-3H3,(H2,10,11) |
| InChIKey | KDVMQTJKKWMMFJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|