C8H12N4O2 — CID 106674394
1-(6-aminopyrimidin-4-yl)pyrrolidine-3,4-diol (PubChem CID 106674394) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-(6-aminopyrimidin-4-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(6-aminopyrimidin-4-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674394 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(6-aminopyrimidin-4-yl)pyrrolidine-3,4-diol |
| SMILES | Nc1cc(N2CC(O)C(O)C2)ncn1 |
| InChI | InChI=1S/C8H12N4O2/c9-7-1-8(11-4-10-7)12-2-5(13)6(14)3-12/h1,4-6,13-14H,2-3H2,(H2,9,10,11) |
| InChIKey | NGZYMKSYGRZEDB-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |