C11H19N5 — CID 81470283
6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-4-amine (PubChem CID 81470283) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-4-amine.
| Compound Name | 6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 81470283 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-4-amine |
| SMILES | CC1CN(c2cc(N)ncn2)CC1N(C)C |
| InChI | InChI=1S/C11H19N5/c1-8-5-16(6-9(8)15(2)3)11-4-10(12)13-7-14-11/h4,7-9H,5-6H2,1-3H3,(H2,12,13,14) |
| InChIKey | RQNHYIUWMXPZHT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |