C8H9F3N4 — CID 129261237
6-[3-(trifluoromethyl)azetidin-1-yl]pyrimidin-4-amine (PubChem CID 129261237) has the molecular formula C8H9F3N4 and a molecular weight of 218.18 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)azetidin-1-yl]pyrimidin-4-amine.
| Compound Name | 6-[3-(trifluoromethyl)azetidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129261237 |
| Molecular Formula | C8H9F3N4 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 6-[3-(trifluoromethyl)azetidin-1-yl]pyrimidin-4-amine |
| SMILES | Nc1cc(N2CC(C(F)(F)F)C2)ncn1 |
| InChI | InChI=1S/C8H9F3N4/c9-8(10,11)5-2-15(3-5)7-1-6(12)13-4-14-7/h1,4-5H,2-3H2,(H2,12,13,14) |
| InChIKey | IPHGCDOKQMGHAN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |