C21H32O6 — CID 10667487
[1-(3,5-dihydroxyphenyl)-7-hydroxy-8-oxotridecan-2-yl] acetate (PubChem CID 10667487) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [1-(3,5-dihydroxyphenyl)-7-hydroxy-8-oxotridecan-2-yl] acetate.
| Compound Name | [1-(3,5-dihydroxyphenyl)-7-hydroxy-8-oxotridecan-2-yl] acetate |
|---|---|
| PubChem CID | 10667487 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [1-(3,5-dihydroxyphenyl)-7-hydroxy-8-oxotridecan-2-yl] acetate |
| SMILES | CCCCCC(=O)C(O)CCCCC(Cc1cc(O)cc(O)c1)OC(C)=O |
| InChI | InChI=1S/C21H32O6/c1-3-4-5-9-20(25)21(26)10-7-6-8-19(27-15(2)22)13-16-11-17(23)14-18(24)12-16/h11-12,14,19,21,23-24,26H,3-10,13H2,1-2H3 |
| InChIKey | QMJQLLLAVKGPQF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|