C22H36O5 — CID 163094478
[(2R,8S)-8-hydroxy-1-(3-hydroxy-5-methoxyphenyl)tridecan-2-yl] acetate (PubChem CID 163094478) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(2R,8S)-8-hydroxy-1-(3-hydroxy-5-methoxyphenyl)tridecan-2-yl] acetate.
| Compound Name | [(2R,8S)-8-hydroxy-1-(3-hydroxy-5-methoxyphenyl)tridecan-2-yl] acetate |
|---|---|
| PubChem CID | 163094478 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [(2R,8S)-8-hydroxy-1-(3-hydroxy-5-methoxyphenyl)tridecan-2-yl] acetate |
| SMILES | CCCCC[C@H](O)CCCCC[C@H](Cc1cc(O)cc(OC)c1)OC(C)=O |
| InChI | InChI=1S/C22H36O5/c1-4-5-7-10-19(24)11-8-6-9-12-21(27-17(2)23)14-18-13-20(25)16-22(15-18)26-3/h13,15-16,19,21,24-25H,4-12,14H2,1-3H3/t19-,21+/m0/s1 |
| InChIKey | ZRBHQPSMRLKWPU-PZJWPPBQSA-N |
| XLogP | 4.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|