C19H29NO4 — CID 70380566
[1-[(3-methoxyphenyl)methylamino]-1-oxononan-4-yl] acetate (PubChem CID 70380566) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is [1-[(3-methoxyphenyl)methylamino]-1-oxononan-4-yl] acetate.
| Compound Name | [1-[(3-methoxyphenyl)methylamino]-1-oxononan-4-yl] acetate |
|---|---|
| PubChem CID | 70380566 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [1-[(3-methoxyphenyl)methylamino]-1-oxononan-4-yl] acetate |
| SMILES | CCCCCC(CCC(=O)NCc1cccc(OC)c1)OC(C)=O |
| InChI | InChI=1S/C19H29NO4/c1-4-5-6-9-17(24-15(2)21)11-12-19(22)20-14-16-8-7-10-18(13-16)23-3/h7-8,10,13,17H,4-6,9,11-12,14H2,1-3H3,(H,20,22) |
| InChIKey | YWSLQUGBMZDEPG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|