C21H34O5 — CID 73074956
[1-(3,5-dihydroxyphenyl)-11-hydroxytridecan-2-yl] acetate (PubChem CID 73074956) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is [1-(3,5-dihydroxyphenyl)-11-hydroxytridecan-2-yl] acetate.
| Compound Name | [1-(3,5-dihydroxyphenyl)-11-hydroxytridecan-2-yl] acetate |
|---|---|
| PubChem CID | 73074956 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | [1-(3,5-dihydroxyphenyl)-11-hydroxytridecan-2-yl] acetate |
| SMILES | CCC(O)CCCCCCCCC(Cc1cc(O)cc(O)c1)OC(C)=O |
| InChI | InChI=1S/C21H34O5/c1-3-18(23)10-8-6-4-5-7-9-11-21(26-16(2)22)14-17-12-19(24)15-20(25)13-17/h12-13,15,18,21,23-25H,3-11,14H2,1-2H3 |
| InChIKey | NNSXNUFHPOAPLQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|