C14H19N3O2 — CID 106675096
N-(3-methoxy-3-methylbutyl)-3-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 106675096) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(3-methoxy-3-methylbutyl)-3-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | N-(3-methoxy-3-methylbutyl)-3-(1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 106675096 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(3-methoxy-3-methylbutyl)-3-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | COC(C)(C)CCNc1cccc(-c2nnco2)c1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,18-3)7-8-15-12-6-4-5-11(9-12)13-17-16-10-19-13/h4-6,9-10,15H,7-8H2,1-3H3 |
| InChIKey | CTFNCZTYIHTAMY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |