C11H14N4S — CID 106678405
1-([1,3]thiazolo[4,5-b]pyrazin-2-yl)cyclohexan-1-amine (PubChem CID 106678405) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 1-([1,3]thiazolo[4,5-b]pyrazin-2-yl)cyclohexan-1-amine.
| Compound Name | 1-([1,3]thiazolo[4,5-b]pyrazin-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 106678405 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-([1,3]thiazolo[4,5-b]pyrazin-2-yl)cyclohexan-1-amine |
| SMILES | NC1(c2nc3nccnc3s2)CCCCC1 |
| InChI | InChI=1S/C11H14N4S/c12-11(4-2-1-3-5-11)10-15-8-9(16-10)14-7-6-13-8/h6-7H,1-5,12H2 |
| InChIKey | FWQAJEBQWJQLKL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |