C10H16N2S — CID 61336907
1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine (PubChem CID 61336907) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 61336907 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine |
| SMILES | Cc1csc(C2(N)CCCCC2)n1 |
| InChI | InChI=1S/C10H16N2S/c1-8-7-13-9(12-8)10(11)5-3-2-4-6-10/h7H,2-6,11H2,1H3 |
| InChIKey | BLKYVFHZDBEFQD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |