C11H19N3S — CID 61332240
1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidin-4-amine (PubChem CID 61332240) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidin-4-amine.
| Compound Name | 1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 61332240 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidin-4-amine |
| SMILES | CCN1CCC(N)(c2nc(C)cs2)CC1 |
| InChI | InChI=1S/C11H19N3S/c1-3-14-6-4-11(12,5-7-14)10-13-9(2)8-15-10/h8H,3-7,12H2,1-2H3 |
| InChIKey | WBCAFDDRJSHMLD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |