C12H21N3S — CID 65077391
1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)azepan-4-amine (PubChem CID 65077391) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)azepan-4-amine.
| Compound Name | 1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)azepan-4-amine |
|---|---|
| PubChem CID | 65077391 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-ethyl-4-(4-methyl-1,3-thiazol-2-yl)azepan-4-amine |
| SMILES | CCN1CCCC(N)(c2nc(C)cs2)CC1 |
| InChI | InChI=1S/C12H21N3S/c1-3-15-7-4-5-12(13,6-8-15)11-14-10(2)9-16-11/h9H,3-8,13H2,1-2H3 |
| InChIKey | KVQBOJFHSYHDNF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |