C20H29NO7 — CID 10668397
ethyl (2S)-5-[2-(methoxymethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 10668397) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is ethyl (2S)-5-[2-(methoxymethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | ethyl (2S)-5-[2-(methoxymethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 10668397 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | ethyl (2S)-5-[2-(methoxymethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)c1ccccc1OCOC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO7/c1-6-26-18(23)15(21-19(24)28-20(2,3)4)11-12-16(22)14-9-7-8-10-17(14)27-13-25-5/h7-10,15H,6,11-13H2,1-5H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | IYUUSVSAYZFUQQ-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|