C19H19Cl2NO4 — CID 10668436
[[(3R,4R)-1-benzyl-3-chloro-4-(chloromethyl)-2-oxopyrrolidin-3-yl]-(furan-2-yl)methyl] acetate (PubChem CID 10668436) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is [[(3R,4R)-1-benzyl-3-chloro-4-(chloromethyl)-2-oxopyrrolidin-3-yl]-(furan-2-yl)methyl] acetate.
| Compound Name | [[(3R,4R)-1-benzyl-3-chloro-4-(chloromethyl)-2-oxopyrrolidin-3-yl]-(furan-2-yl)methyl] acetate |
|---|---|
| PubChem CID | 10668436 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | [[(3R,4R)-1-benzyl-3-chloro-4-(chloromethyl)-2-oxopyrrolidin-3-yl]-(furan-2-yl)methyl] acetate |
| SMILES | CC(=O)OC(c1ccco1)[C@@]1(Cl)C(=O)N(Cc2ccccc2)C[C@@H]1CCl |
| InChI | InChI=1S/C19H19Cl2NO4/c1-13(23)26-17(16-8-5-9-25-16)19(21)15(10-20)12-22(18(19)24)11-14-6-3-2-4-7-14/h2-9,15,17H,10-12H2,1H3/t15-,17?,19+/m0/s1 |
| InChIKey | UFTHZLBFFZRLNZ-APROBQCTSA-N |
| XLogP | 3.76 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|