C14H10ClN3O3 — CID 106685541
2-chloro-N-[4-(2-oxo-1H-imidazol-3-yl)phenyl]furan-3-carboxamide (PubChem CID 106685541) has the molecular formula C14H10ClN3O3 and a molecular weight of 303.71 g/mol. Its IUPAC name is 2-chloro-N-[4-(2-oxo-1H-imidazol-3-yl)phenyl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[4-(2-oxo-1H-imidazol-3-yl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106685541 |
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-chloro-N-[4-(2-oxo-1H-imidazol-3-yl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cc[nH]c2=O)cc1)c1ccoc1Cl |
| InChI | InChI=1S/C14H10ClN3O3/c15-12-11(5-8-21-12)13(19)17-9-1-3-10(4-2-9)18-7-6-16-14(18)20/h1-8H,(H,16,20)(H,17,19) |
| InChIKey | OVNVMDAXKUTOOA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |