C19H38OSn — CID 10668737
(2E,4E)-3-methyl-4-tributylstannylhexa-2,4-dien-1-ol (PubChem CID 10668737) has the molecular formula C19H38OSn and a molecular weight of 401.22 g/mol. Its IUPAC name is (2E,4E)-3-methyl-4-tributylstannylhexa-2,4-dien-1-ol.
| Compound Name | (2E,4E)-3-methyl-4-tributylstannylhexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 10668737 |
| Molecular Formula | C19H38OSn |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (2E,4E)-3-methyl-4-tributylstannylhexa-2,4-dien-1-ol |
| SMILES | C/C=C(C(\C)=C\CO)/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C7H11O.3C4H9.Sn/c1-3-4-7(2)5-6-8;3*1-3-4-2;/h3,5,8H,6H2,1-2H3;3*1,3-4H2,2H3;/b4-3?,7-5+;;;; |
| InChIKey | KDIVZTDLBCVZQJ-AVTZJOPJSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|